C12H27N3O2 — CID 66181213
2-(4-ethylpiperazin-1-yl)-3,3-dimethoxy-2-methylpropan-1-amine (PubChem CID 66181213) has the molecular formula C12H27N3O2 and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-3,3-dimethoxy-2-methylpropan-1-amine.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-3,3-dimethoxy-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 66181213 |
| Molecular Formula | C12H27N3O2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-3,3-dimethoxy-2-methylpropan-1-amine |
| SMILES | CCN1CCN(C(C)(CN)C(OC)OC)CC1 |
| InChI | InChI=1S/C12H27N3O2/c1-5-14-6-8-15(9-7-14)12(2,10-13)11(16-3)17-4/h11H,5-10,13H2,1-4H3 |
| InChIKey | BEKANRFUMJGPOA-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|