C12H16F2N2 — CID 66181429
N-[(2,3-difluorophenyl)methyl]-N-ethylazetidin-3-amine (PubChem CID 66181429) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is N-[(2,3-difluorophenyl)methyl]-N-ethylazetidin-3-amine.
| Compound Name | N-[(2,3-difluorophenyl)methyl]-N-ethylazetidin-3-amine |
|---|---|
| PubChem CID | 66181429 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N-[(2,3-difluorophenyl)methyl]-N-ethylazetidin-3-amine |
| SMILES | CCN(Cc1cccc(F)c1F)C1CNC1 |
| InChI | InChI=1S/C12H16F2N2/c1-2-16(10-6-15-7-10)8-9-4-3-5-11(13)12(9)14/h3-5,10,15H,2,6-8H2,1H3 |
| InChIKey | SAKPNWPNWKYOJA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |