C13H18F2N2O — CID 66182713
N-[[2-(difluoromethoxy)phenyl]methyl]-N-ethylazetidin-3-amine (PubChem CID 66182713) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-N-ethylazetidin-3-amine.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-N-ethylazetidin-3-amine |
|---|---|
| PubChem CID | 66182713 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-N-ethylazetidin-3-amine |
| SMILES | CCN(Cc1ccccc1OC(F)F)C1CNC1 |
| InChI | InChI=1S/C13H18F2N2O/c1-2-17(11-7-16-8-11)9-10-5-3-4-6-12(10)18-13(14)15/h3-6,11,13,16H,2,7-9H2,1H3 |
| InChIKey | KHWHMPTTXQIESG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |