C11H13F2N3O2 — CID 66181559
N-(2,3-difluoro-6-nitrophenyl)-N-ethylazetidin-3-amine (PubChem CID 66181559) has the molecular formula C11H13F2N3O2 and a molecular weight of 257.24 g/mol. Its IUPAC name is N-(2,3-difluoro-6-nitrophenyl)-N-ethylazetidin-3-amine.
| Compound Name | N-(2,3-difluoro-6-nitrophenyl)-N-ethylazetidin-3-amine |
|---|---|
| PubChem CID | 66181559 |
| Molecular Formula | C11H13F2N3O2 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-(2,3-difluoro-6-nitrophenyl)-N-ethylazetidin-3-amine |
| SMILES | CCN(c1c([N+](=O)[O-])ccc(F)c1F)C1CNC1 |
| InChI | InChI=1S/C11H13F2N3O2/c1-2-15(7-5-14-6-7)11-9(16(17)18)4-3-8(12)10(11)13/h3-4,7,14H,2,5-6H2,1H3 |
| InChIKey | GYEZDGYNHFAYQU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|