C9H10F2N2O2 — CID 134441637
N-ethyl-2,6-difluoro-N-methyl-3-nitroaniline (PubChem CID 134441637) has the molecular formula C9H10F2N2O2 and a molecular weight of 216.19 g/mol. Its IUPAC name is N-ethyl-2,6-difluoro-N-methyl-3-nitroaniline.
| Compound Name | N-ethyl-2,6-difluoro-N-methyl-3-nitroaniline |
|---|---|
| PubChem CID | 134441637 |
| Molecular Formula | C9H10F2N2O2 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | N-ethyl-2,6-difluoro-N-methyl-3-nitroaniline |
| SMILES | CCN(C)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C9H10F2N2O2/c1-3-12(2)9-6(10)4-5-7(8(9)11)13(14)15/h4-5H,3H2,1-2H3 |
| InChIKey | KHAWFRPZLDWSLH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|