C11H14ClFN2O2S — CID 66182987
N-(azetidin-3-yl)-3-chloro-N-ethyl-2-fluorobenzenesulfonamide (PubChem CID 66182987) has the molecular formula C11H14ClFN2O2S and a molecular weight of 292.76 g/mol. Its IUPAC name is N-(azetidin-3-yl)-3-chloro-N-ethyl-2-fluorobenzenesulfonamide.
| Compound Name | N-(azetidin-3-yl)-3-chloro-N-ethyl-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 66182987 |
| Molecular Formula | C11H14ClFN2O2S |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | N-(azetidin-3-yl)-3-chloro-N-ethyl-2-fluorobenzenesulfonamide |
| SMILES | CCN(C1CNC1)S(=O)(=O)c1cccc(Cl)c1F |
| InChI | InChI=1S/C11H14ClFN2O2S/c1-2-15(8-6-14-7-8)18(16,17)10-5-3-4-9(12)11(10)13/h3-5,8,14H,2,6-7H2,1H3 |
| InChIKey | RDZCBDIINMZTCR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |