C11H17BrN2S — CID 66183275
N-[(4-bromothiophen-2-yl)methyl]-N-propylazetidin-3-amine (PubChem CID 66183275) has the molecular formula C11H17BrN2S and a molecular weight of 289.24 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N-propylazetidin-3-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N-propylazetidin-3-amine |
|---|---|
| PubChem CID | 66183275 |
| Molecular Formula | C11H17BrN2S |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N-propylazetidin-3-amine |
| SMILES | CCCN(Cc1cc(Br)cs1)C1CNC1 |
| InChI | InChI=1S/C11H17BrN2S/c1-2-3-14(10-5-13-6-10)7-11-4-9(12)8-15-11/h4,8,10,13H,2-3,5-7H2,1H3 |
| InChIKey | TUILLFJBTCUKKD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |