C11H17BrN2O — CID 106885984
N-[(3-bromofuran-2-yl)methyl]-N-propylazetidin-3-amine (PubChem CID 106885984) has the molecular formula C11H17BrN2O and a molecular weight of 273.17 g/mol. Its IUPAC name is N-[(3-bromofuran-2-yl)methyl]-N-propylazetidin-3-amine.
| Compound Name | N-[(3-bromofuran-2-yl)methyl]-N-propylazetidin-3-amine |
|---|---|
| PubChem CID | 106885984 |
| Molecular Formula | C11H17BrN2O |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | N-[(3-bromofuran-2-yl)methyl]-N-propylazetidin-3-amine |
| SMILES | CCCN(Cc1occc1Br)C1CNC1 |
| InChI | InChI=1S/C11H17BrN2O/c1-2-4-14(9-6-13-7-9)8-11-10(12)3-5-15-11/h3,5,9,13H,2,4,6-8H2,1H3 |
| InChIKey | YLOQXJRFRDEKTG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |