C20H23N3O — CID 661833
2-[[(1-propan-2-ylbenzimidazol-2-yl)amino]methyl]-6-prop-2-enylphenol (PubChem CID 661833) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-[[(1-propan-2-ylbenzimidazol-2-yl)amino]methyl]-6-prop-2-enylphenol.
| Compound Name | 2-[[(1-propan-2-ylbenzimidazol-2-yl)amino]methyl]-6-prop-2-enylphenol |
|---|---|
| PubChem CID | 661833 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 2-[[(1-propan-2-ylbenzimidazol-2-yl)amino]methyl]-6-prop-2-enylphenol |
| SMILES | C=CCc1cccc(CNc2nc3ccccc3n2C(C)C)c1O |
| InChI | InChI=1S/C20H23N3O/c1-4-8-15-9-7-10-16(19(15)24)13-21-20-22-17-11-5-6-12-18(17)23(20)14(2)3/h4-7,9-12,14,24H,1,8,13H2,2-3H3,(H,21,22) |
| InChIKey | KVSQJRLYXTVULX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|