C16H16BrNO — CID 753626
2-[(4-bromoanilino)methyl]-6-prop-2-enylphenol (PubChem CID 753626) has the molecular formula C16H16BrNO and a molecular weight of 318.21 g/mol. Its IUPAC name is 2-[(4-bromoanilino)methyl]-6-prop-2-enylphenol.
| Compound Name | 2-[(4-bromoanilino)methyl]-6-prop-2-enylphenol |
|---|---|
| PubChem CID | 753626 |
| Molecular Formula | C16H16BrNO |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-[(4-bromoanilino)methyl]-6-prop-2-enylphenol |
| SMILES | C=CCc1cccc(CNc2ccc(Br)cc2)c1O |
| InChI | InChI=1S/C16H16BrNO/c1-2-4-12-5-3-6-13(16(12)19)11-18-15-9-7-14(17)8-10-15/h2-3,5-10,18-19H,1,4,11H2 |
| InChIKey | VTCAYYAODRNKKJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|