C11H12F3N3O — CID 66187502
4-(azetidin-3-ylamino)-2-(trifluoromethyl)benzamide (PubChem CID 66187502) has the molecular formula C11H12F3N3O and a molecular weight of 259.23 g/mol. Its IUPAC name is 4-(azetidin-3-ylamino)-2-(trifluoromethyl)benzamide.
| Compound Name | 4-(azetidin-3-ylamino)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 66187502 |
| Molecular Formula | C11H12F3N3O |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 4-(azetidin-3-ylamino)-2-(trifluoromethyl)benzamide |
| SMILES | NC(=O)c1ccc(NC2CNC2)cc1C(F)(F)F |
| InChI | InChI=1S/C11H12F3N3O/c12-11(13,14)9-3-6(17-7-4-16-5-7)1-2-8(9)10(15)18/h1-3,7,16-17H,4-5H2,(H2,15,18) |
| InChIKey | LATRTIJGXHXUKY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |