C11H13N5O — CID 66189085
2-(3-azidopropylamino)-2-(3-hydroxyphenyl)acetonitrile (PubChem CID 66189085) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is 2-(3-azidopropylamino)-2-(3-hydroxyphenyl)acetonitrile.
| Compound Name | 2-(3-azidopropylamino)-2-(3-hydroxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 66189085 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-(3-azidopropylamino)-2-(3-hydroxyphenyl)acetonitrile |
| SMILES | N#CC(NCCCN=[N+]=[N-])c1cccc(O)c1 |
| InChI | InChI=1S/C11H13N5O/c12-8-11(14-5-2-6-15-16-13)9-3-1-4-10(17)7-9/h1,3-4,7,11,14,17H,2,5-6H2 |
| InChIKey | WMILAKPBFXPFBN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|