C13H17N5 — CID 66190070
2-(3-azidopropylamino)-2-(3,4-dimethylphenyl)acetonitrile (PubChem CID 66190070) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-(3-azidopropylamino)-2-(3,4-dimethylphenyl)acetonitrile.
| Compound Name | 2-(3-azidopropylamino)-2-(3,4-dimethylphenyl)acetonitrile |
|---|---|
| PubChem CID | 66190070 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 2-(3-azidopropylamino)-2-(3,4-dimethylphenyl)acetonitrile |
| SMILES | Cc1ccc(C(C#N)NCCCN=[N+]=[N-])cc1C |
| InChI | InChI=1S/C13H17N5/c1-10-4-5-12(8-11(10)2)13(9-14)16-6-3-7-17-18-15/h4-5,8,13,16H,3,6-7H2,1-2H3 |
| InChIKey | KAGAXOYMYDZLNL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|