C13H17N5O2 — CID 66188693
2-(3-azidopropylamino)-2-(2,3-dimethoxyphenyl)acetonitrile (PubChem CID 66188693) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-(3-azidopropylamino)-2-(2,3-dimethoxyphenyl)acetonitrile.
| Compound Name | 2-(3-azidopropylamino)-2-(2,3-dimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 66188693 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 2-(3-azidopropylamino)-2-(2,3-dimethoxyphenyl)acetonitrile |
| SMILES | COc1cccc(C(C#N)NCCCN=[N+]=[N-])c1OC |
| InChI | InChI=1S/C13H17N5O2/c1-19-12-6-3-5-10(13(12)20-2)11(9-14)16-7-4-8-17-18-15/h3,5-6,11,16H,4,7-8H2,1-2H3 |
| InChIKey | SUNOKLQGSNVYEN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|