C12H15N5O2 — CID 66191166
2-(2-azidoethylamino)-2-(2,5-dimethoxyphenyl)acetonitrile (PubChem CID 66191166) has the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-(2-azidoethylamino)-2-(2,5-dimethoxyphenyl)acetonitrile.
| Compound Name | 2-(2-azidoethylamino)-2-(2,5-dimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 66191166 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-(2-azidoethylamino)-2-(2,5-dimethoxyphenyl)acetonitrile |
| SMILES | COc1ccc(OC)c(C(C#N)NCCN=[N+]=[N-])c1 |
| InChI | InChI=1S/C12H15N5O2/c1-18-9-3-4-12(19-2)10(7-9)11(8-13)15-5-6-16-17-14/h3-4,7,11,15H,5-6H2,1-2H3 |
| InChIKey | YHMTXTXEBYCGMT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|