C12H16N4O4 — CID 66189802
2-(2-azidoethylamino)-2-(2,5-dimethoxyphenyl)acetic acid (PubChem CID 66189802) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-(2-azidoethylamino)-2-(2,5-dimethoxyphenyl)acetic acid.
| Compound Name | 2-(2-azidoethylamino)-2-(2,5-dimethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 66189802 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-(2-azidoethylamino)-2-(2,5-dimethoxyphenyl)acetic acid |
| SMILES | COc1ccc(OC)c(C(NCCN=[N+]=[N-])C(=O)O)c1 |
| InChI | InChI=1S/C12H16N4O4/c1-19-8-3-4-10(20-2)9(7-8)11(12(17)18)14-5-6-15-16-13/h3-4,7,11,14H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | ILZYNQKYEUNNQO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|