C10H8F3N5 — CID 66190376
2-(2-azidoethylamino)-2-(3,4,5-trifluorophenyl)acetonitrile (PubChem CID 66190376) has the molecular formula C10H8F3N5 and a molecular weight of 255.20 g/mol. Its IUPAC name is 2-(2-azidoethylamino)-2-(3,4,5-trifluorophenyl)acetonitrile.
| Compound Name | 2-(2-azidoethylamino)-2-(3,4,5-trifluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 66190376 |
| Molecular Formula | C10H8F3N5 |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-(2-azidoethylamino)-2-(3,4,5-trifluorophenyl)acetonitrile |
| SMILES | N#CC(NCCN=[N+]=[N-])c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H8F3N5/c11-7-3-6(4-8(12)10(7)13)9(5-14)16-1-2-17-18-15/h3-4,9,16H,1-2H2 |
| InChIKey | VLJOOEOCXQQYIP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|