C10H6F6N2 — CID 63078195
2-(2,2,2-trifluoroethylamino)-2-(3,4,5-trifluorophenyl)acetonitrile (PubChem CID 63078195) has the molecular formula C10H6F6N2 and a molecular weight of 268.16 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethylamino)-2-(3,4,5-trifluorophenyl)acetonitrile.
| Compound Name | 2-(2,2,2-trifluoroethylamino)-2-(3,4,5-trifluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 63078195 |
| Molecular Formula | C10H6F6N2 |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 2-(2,2,2-trifluoroethylamino)-2-(3,4,5-trifluorophenyl)acetonitrile |
| SMILES | N#CC(NCC(F)(F)F)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H6F6N2/c11-6-1-5(2-7(12)9(6)13)8(3-17)18-4-10(14,15)16/h1-2,8,18H,4H2 |
| InChIKey | GEKXDNRANZAMFB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|