C16H15FN2O2 — CID 60987531
2-(2,5-dimethoxyphenyl)-2-(4-fluoroanilino)acetonitrile (PubChem CID 60987531) has the molecular formula C16H15FN2O2 and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-2-(4-fluoroanilino)acetonitrile.
| Compound Name | 2-(2,5-dimethoxyphenyl)-2-(4-fluoroanilino)acetonitrile |
|---|---|
| PubChem CID | 60987531 |
| Molecular Formula | C16H15FN2O2 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-2-(4-fluoroanilino)acetonitrile |
| SMILES | COc1ccc(OC)c(C(C#N)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C16H15FN2O2/c1-20-13-7-8-16(21-2)14(9-13)15(10-18)19-12-5-3-11(17)4-6-12/h3-9,15,19H,1-2H3 |
| InChIKey | UFJRYTLQOVXSPW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |