C17H18N2O3 — CID 102232248
2-anilino-2-(2,3,4-trimethoxyphenyl)acetonitrile (PubChem CID 102232248) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-anilino-2-(2,3,4-trimethoxyphenyl)acetonitrile.
| Compound Name | 2-anilino-2-(2,3,4-trimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 102232248 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-anilino-2-(2,3,4-trimethoxyphenyl)acetonitrile |
| SMILES | COc1ccc(C(C#N)Nc2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C17H18N2O3/c1-20-15-10-9-13(16(21-2)17(15)22-3)14(11-18)19-12-7-5-4-6-8-12/h4-10,14,19H,1-3H3 |
| InChIKey | IYCAPKDYSSZENB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |