C13H13ClN2O2 — CID 63632909
2-(2-chloro-3,4-dimethoxyphenyl)-2-(prop-2-ynylamino)acetonitrile (PubChem CID 63632909) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is 2-(2-chloro-3,4-dimethoxyphenyl)-2-(prop-2-ynylamino)acetonitrile.
| Compound Name | 2-(2-chloro-3,4-dimethoxyphenyl)-2-(prop-2-ynylamino)acetonitrile |
|---|---|
| PubChem CID | 63632909 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-(2-chloro-3,4-dimethoxyphenyl)-2-(prop-2-ynylamino)acetonitrile |
| SMILES | C#CCNC(C#N)c1ccc(OC)c(OC)c1Cl |
| InChI | InChI=1S/C13H13ClN2O2/c1-4-7-16-10(8-15)9-5-6-11(17-2)13(18-3)12(9)14/h1,5-6,10,16H,7H2,2-3H3 |
| InChIKey | XGYBAJXGSQXKOY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|