C10H9Cl2NO2 — CID 63632067
2-chloro-2-(2-chloro-3,4-dimethoxyphenyl)acetonitrile (PubChem CID 63632067) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is 2-chloro-2-(2-chloro-3,4-dimethoxyphenyl)acetonitrile.
| Compound Name | 2-chloro-2-(2-chloro-3,4-dimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 63632067 |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | 2-chloro-2-(2-chloro-3,4-dimethoxyphenyl)acetonitrile |
| SMILES | COc1ccc(C(Cl)C#N)c(Cl)c1OC |
| InChI | InChI=1S/C10H9Cl2NO2/c1-14-8-4-3-6(7(11)5-13)9(12)10(8)15-2/h3-4,7H,1-2H3 |
| InChIKey | QEGGPCQSBPAHLT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|