C11H19N5 — CID 66190184
1-(2-azidoethylamino)-2,4-dimethylcyclohexane-1-carbonitrile (PubChem CID 66190184) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 1-(2-azidoethylamino)-2,4-dimethylcyclohexane-1-carbonitrile.
| Compound Name | 1-(2-azidoethylamino)-2,4-dimethylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 66190184 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 1-(2-azidoethylamino)-2,4-dimethylcyclohexane-1-carbonitrile |
| SMILES | CC1CCC(C#N)(NCCN=[N+]=[N-])C(C)C1 |
| InChI | InChI=1S/C11H19N5/c1-9-3-4-11(8-12,10(2)7-9)14-5-6-15-16-13/h9-10,14H,3-7H2,1-2H3 |
| InChIKey | LRYVZELQRYNRRR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|