C12H21N5 — CID 81321554
1-(2-azidoethylamino)-2,4,4-trimethylcyclohexane-1-carbonitrile (PubChem CID 81321554) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-(2-azidoethylamino)-2,4,4-trimethylcyclohexane-1-carbonitrile.
| Compound Name | 1-(2-azidoethylamino)-2,4,4-trimethylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 81321554 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 1-(2-azidoethylamino)-2,4,4-trimethylcyclohexane-1-carbonitrile |
| SMILES | CC1CC(C)(C)CCC1(C#N)NCCN=[N+]=[N-] |
| InChI | InChI=1S/C12H21N5/c1-10-8-11(2,3)4-5-12(10,9-13)15-6-7-16-17-14/h10,15H,4-8H2,1-3H3 |
| InChIKey | SQFRAUJPSNXFPB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|