C21H19FN2O6 — CID 6619094
1-(2,4-dimethoxyphenyl)-5-(4-fluorophenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 6619094) has the molecular formula C21H19FN2O6 and a molecular weight of 414.39 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-5-(4-fluorophenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(2,4-dimethoxyphenyl)-5-(4-fluorophenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 6619094 |
| Molecular Formula | C21H19FN2O6 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-5-(4-fluorophenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1ccc(C2NC(C(=O)O)C3C(=O)N(c4ccc(F)cc4)C(=O)C23)c(OC)c1 |
| InChI | InChI=1S/C21H19FN2O6/c1-29-12-7-8-13(14(9-12)30-2)17-15-16(18(23-17)21(27)28)20(26)24(19(15)25)11-5-3-10(22)4-6-11/h3-9,15-18,23H,1-2H3,(H,27,28) |
| InChIKey | JYDYUWDJAHMVGI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|