C23H24N2O6 — CID 71821116
1-(2,4-dimethoxyphenyl)-5-(2,6-dimethylphenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 71821116) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-5-(2,6-dimethylphenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(2,4-dimethoxyphenyl)-5-(2,6-dimethylphenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 71821116 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-5-(2,6-dimethylphenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1ccc(C2NC(C(=O)O)C3C(=O)N(c4c(C)cccc4C)C(=O)C23)c(OC)c1 |
| InChI | InChI=1S/C23H24N2O6/c1-11-6-5-7-12(2)20(11)25-21(26)16-17(22(25)27)19(23(28)29)24-18(16)14-9-8-13(30-3)10-15(14)31-4/h5-10,16-19,24H,1-4H3,(H,28,29) |
| InChIKey | SEQUFJUXAJSPAV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|