C10H19N5O2 — CID 66192312
N-(2-methoxyethyl)-2-[4-(methylaminomethyl)triazol-1-yl]propanamide (PubChem CID 66192312) has the molecular formula C10H19N5O2 and a molecular weight of 241.29 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[4-(methylaminomethyl)triazol-1-yl]propanamide.
| Compound Name | N-(2-methoxyethyl)-2-[4-(methylaminomethyl)triazol-1-yl]propanamide |
|---|---|
| PubChem CID | 66192312 |
| Molecular Formula | C10H19N5O2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N-(2-methoxyethyl)-2-[4-(methylaminomethyl)triazol-1-yl]propanamide |
| SMILES | CNCc1cn(C(C)C(=O)NCCOC)nn1 |
| InChI | InChI=1S/C10H19N5O2/c1-8(10(16)12-4-5-17-3)15-7-9(6-11-2)13-14-15/h7-8,11H,4-6H2,1-3H3,(H,12,16) |
| InChIKey | WETKHNVDUOXUJB-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|