C11H15BrN4S — CID 66193563
N-[[1-[(5-bromothiophen-3-yl)methyl]triazol-4-yl]methyl]propan-2-amine (PubChem CID 66193563) has the molecular formula C11H15BrN4S and a molecular weight of 315.24 g/mol. Its IUPAC name is N-[[1-[(5-bromothiophen-3-yl)methyl]triazol-4-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-[(5-bromothiophen-3-yl)methyl]triazol-4-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 66193563 |
| Molecular Formula | C11H15BrN4S |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | N-[[1-[(5-bromothiophen-3-yl)methyl]triazol-4-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1cn(Cc2csc(Br)c2)nn1 |
| InChI | InChI=1S/C11H15BrN4S/c1-8(2)13-4-10-6-16(15-14-10)5-9-3-11(12)17-7-9/h3,6-8,13H,4-5H2,1-2H3 |
| InChIKey | CNIOQFLEXOCEOW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |