C11H13BrN4S — CID 66193787
N-[[1-[(5-bromothiophen-3-yl)methyl]triazol-4-yl]methyl]cyclopropanamine (PubChem CID 66193787) has the molecular formula C11H13BrN4S and a molecular weight of 313.22 g/mol. Its IUPAC name is N-[[1-[(5-bromothiophen-3-yl)methyl]triazol-4-yl]methyl]cyclopropanamine.
| Compound Name | N-[[1-[(5-bromothiophen-3-yl)methyl]triazol-4-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 66193787 |
| Molecular Formula | C11H13BrN4S |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | N-[[1-[(5-bromothiophen-3-yl)methyl]triazol-4-yl]methyl]cyclopropanamine |
| SMILES | Brc1cc(Cn2cc(CNC3CC3)nn2)cs1 |
| InChI | InChI=1S/C11H13BrN4S/c12-11-3-8(7-17-11)5-16-6-10(14-15-16)4-13-9-1-2-9/h3,6-7,9,13H,1-2,4-5H2 |
| InChIKey | JGMNXGPXEYBIBA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |