C10H15BrN2O3S2 — CID 66195315
N-(2-amino-4-ethoxycyclobutyl)-5-bromothiophene-2-sulfonamide (PubChem CID 66195315) has the molecular formula C10H15BrN2O3S2 and a molecular weight of 355.28 g/mol. Its IUPAC name is N-(2-amino-4-ethoxycyclobutyl)-5-bromothiophene-2-sulfonamide.
| Compound Name | N-(2-amino-4-ethoxycyclobutyl)-5-bromothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 66195315 |
| Molecular Formula | C10H15BrN2O3S2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | N-(2-amino-4-ethoxycyclobutyl)-5-bromothiophene-2-sulfonamide |
| SMILES | CCOC1CC(N)C1NS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H15BrN2O3S2/c1-2-16-7-5-6(12)10(7)13-18(14,15)9-4-3-8(11)17-9/h3-4,6-7,10,13H,2,5,12H2,1H3 |
| InChIKey | IDPQVXWQHHFJGD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |