C13H18N2O4 — CID 66195669
N-(2-amino-4-ethoxycyclobutyl)-2,4-dihydroxybenzamide (PubChem CID 66195669) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-(2-amino-4-ethoxycyclobutyl)-2,4-dihydroxybenzamide.
| Compound Name | N-(2-amino-4-ethoxycyclobutyl)-2,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 66195669 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N-(2-amino-4-ethoxycyclobutyl)-2,4-dihydroxybenzamide |
| SMILES | CCOC1CC(N)C1NC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C13H18N2O4/c1-2-19-11-6-9(14)12(11)15-13(18)8-4-3-7(16)5-10(8)17/h3-5,9,11-12,16-17H,2,6,14H2,1H3,(H,15,18) |
| InChIKey | XQCGVLSLPSVEFT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |