C13H16F2N2O2 — CID 66197031
N-(2-amino-4-ethoxycyclobutyl)-2,5-difluorobenzamide (PubChem CID 66197031) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is N-(2-amino-4-ethoxycyclobutyl)-2,5-difluorobenzamide.
| Compound Name | N-(2-amino-4-ethoxycyclobutyl)-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 66197031 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-(2-amino-4-ethoxycyclobutyl)-2,5-difluorobenzamide |
| SMILES | CCOC1CC(N)C1NC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H16F2N2O2/c1-2-19-11-6-10(16)12(11)17-13(18)8-5-7(14)3-4-9(8)15/h3-5,10-12H,2,6,16H2,1H3,(H,17,18) |
| InChIKey | XNPNMNZYLYELPV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |