C12H16FN3O2 — CID 104639313
N-(2-amino-4-ethoxycyclobutyl)-5-fluoropyridine-2-carboxamide (PubChem CID 104639313) has the molecular formula C12H16FN3O2 and a molecular weight of 253.28 g/mol. Its IUPAC name is N-(2-amino-4-ethoxycyclobutyl)-5-fluoropyridine-2-carboxamide.
| Compound Name | N-(2-amino-4-ethoxycyclobutyl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 104639313 |
| Molecular Formula | C12H16FN3O2 |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N-(2-amino-4-ethoxycyclobutyl)-5-fluoropyridine-2-carboxamide |
| SMILES | CCOC1CC(N)C1NC(=O)c1ccc(F)cn1 |
| InChI | InChI=1S/C12H16FN3O2/c1-2-18-10-5-8(14)11(10)16-12(17)9-4-3-7(13)6-15-9/h3-4,6,8,10-11H,2,5,14H2,1H3,(H,16,17) |
| InChIKey | SSVXATCXBSLWHW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |