C11H14N2O2S — CID 66196694
N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)thiophene-3-carboxamide (PubChem CID 66196694) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)thiophene-3-carboxamide.
| Compound Name | N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 66196694 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)thiophene-3-carboxamide |
| SMILES | NC1C2CCOC2C1NC(=O)c1ccsc1 |
| InChI | InChI=1S/C11H14N2O2S/c12-8-7-1-3-15-10(7)9(8)13-11(14)6-2-4-16-5-6/h2,4-5,7-10H,1,3,12H2,(H,13,14) |
| InChIKey | MIANKJQGMNNSEC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |