C14H18N2O3 — CID 107672150
N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4-hydroxy-3-methylbenzamide (PubChem CID 107672150) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4-hydroxy-3-methylbenzamide.
| Compound Name | N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4-hydroxy-3-methylbenzamide |
|---|---|
| PubChem CID | 107672150 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4-hydroxy-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NC2C(N)C3CCOC32)ccc1O |
| InChI | InChI=1S/C14H18N2O3/c1-7-6-8(2-3-10(7)17)14(18)16-12-11(15)9-4-5-19-13(9)12/h2-3,6,9,11-13,17H,4-5,15H2,1H3,(H,16,18) |
| InChIKey | IVNCGLUEYMEKPD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |