C13H15ClN2O3 — CID 66196124
N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-5-chloro-2-hydroxybenzamide (PubChem CID 66196124) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-5-chloro-2-hydroxybenzamide.
| Compound Name | N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-5-chloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 66196124 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-5-chloro-2-hydroxybenzamide |
| SMILES | NC1C2CCOC2C1NC(=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C13H15ClN2O3/c14-6-1-2-9(17)8(5-6)13(18)16-11-10(15)7-3-4-19-12(7)11/h1-2,5,7,10-12,17H,3-4,15H2,(H,16,18) |
| InChIKey | WXENLETYQRJOGT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |