C14H16BrFN2O2 — CID 66212893
N-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-5-bromo-2-fluorobenzamide (PubChem CID 66212893) has the molecular formula C14H16BrFN2O2 and a molecular weight of 343.20 g/mol. Its IUPAC name is N-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-5-bromo-2-fluorobenzamide.
| Compound Name | N-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-5-bromo-2-fluorobenzamide |
|---|---|
| PubChem CID | 66212893 |
| Molecular Formula | C14H16BrFN2O2 |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | N-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-5-bromo-2-fluorobenzamide |
| SMILES | NC1C2CCCOC2C1NC(=O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C14H16BrFN2O2/c15-7-3-4-10(16)9(6-7)14(19)18-12-11(17)8-2-1-5-20-13(8)12/h3-4,6,8,11-13H,1-2,5,17H2,(H,18,19) |
| InChIKey | NBDRWXORIATWCX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |