C14H18N2O4 — CID 114345078
N-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-2,3-dihydroxybenzamide (PubChem CID 114345078) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-2,3-dihydroxybenzamide.
| Compound Name | N-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114345078 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-2,3-dihydroxybenzamide |
| SMILES | NC1C2CCCOC2C1NC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C14H18N2O4/c15-10-7-4-2-6-20-13(7)11(10)16-14(19)8-3-1-5-9(17)12(8)18/h1,3,5,7,10-11,13,17-18H,2,4,6,15H2,(H,16,19) |
| InChIKey | JXNDIGWUZPZIOO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|