C17H24N2O2 — CID 66198768
4-(2-methoxyphenyl)-5-(2,3,3-trimethylbutyl)-1,2-oxazol-3-amine (PubChem CID 66198768) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-5-(2,3,3-trimethylbutyl)-1,2-oxazol-3-amine.
| Compound Name | 4-(2-methoxyphenyl)-5-(2,3,3-trimethylbutyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66198768 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 4-(2-methoxyphenyl)-5-(2,3,3-trimethylbutyl)-1,2-oxazol-3-amine |
| SMILES | COc1ccccc1-c1c(N)noc1CC(C)C(C)(C)C |
| InChI | InChI=1S/C17H24N2O2/c1-11(17(2,3)4)10-14-15(16(18)19-21-14)12-8-6-7-9-13(12)20-5/h6-9,11H,10H2,1-5H3,(H2,18,19) |
| InChIKey | RNZUGJNZGBYCJD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |