C13H9FN2OS — CID 66199158
4-(2-fluorophenyl)-5-thiophen-3-yl-1,2-oxazol-3-amine (PubChem CID 66199158) has the molecular formula C13H9FN2OS and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-5-thiophen-3-yl-1,2-oxazol-3-amine.
| Compound Name | 4-(2-fluorophenyl)-5-thiophen-3-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66199158 |
| Molecular Formula | C13H9FN2OS |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 4-(2-fluorophenyl)-5-thiophen-3-yl-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2ccsc2)c1-c1ccccc1F |
| InChI | InChI=1S/C13H9FN2OS/c14-10-4-2-1-3-9(10)11-12(17-16-13(11)15)8-5-6-18-7-8/h1-7H,(H2,15,16) |
| InChIKey | CUYPEEXENYZIFX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |