C11H9F3N2O — CID 66199635
4-ethyl-5-(2,4,6-trifluorophenyl)-1,2-oxazol-3-amine (PubChem CID 66199635) has the molecular formula C11H9F3N2O and a molecular weight of 242.20 g/mol. Its IUPAC name is 4-ethyl-5-(2,4,6-trifluorophenyl)-1,2-oxazol-3-amine.
| Compound Name | 4-ethyl-5-(2,4,6-trifluorophenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66199635 |
| Molecular Formula | C11H9F3N2O |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 4-ethyl-5-(2,4,6-trifluorophenyl)-1,2-oxazol-3-amine |
| SMILES | CCc1c(N)noc1-c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C11H9F3N2O/c1-2-6-10(17-16-11(6)15)9-7(13)3-5(12)4-8(9)14/h3-4H,2H2,1H3,(H2,15,16) |
| InChIKey | NXGGTLTXPSFRAF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |