C12H19N5 — CID 66201241
4-[4-(azetidin-3-yl)piperazin-1-yl]-6-methylpyrimidine (PubChem CID 66201241) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 4-[4-(azetidin-3-yl)piperazin-1-yl]-6-methylpyrimidine.
| Compound Name | 4-[4-(azetidin-3-yl)piperazin-1-yl]-6-methylpyrimidine |
|---|---|
| PubChem CID | 66201241 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 4-[4-(azetidin-3-yl)piperazin-1-yl]-6-methylpyrimidine |
| SMILES | Cc1cc(N2CCN(C3CNC3)CC2)ncn1 |
| InChI | InChI=1S/C12H19N5/c1-10-6-12(15-9-14-10)17-4-2-16(3-5-17)11-7-13-8-11/h6,9,11,13H,2-5,7-8H2,1H3 |
| InChIKey | XLTPGHPKOMFLKL-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |