C23H23N5O3 — CID 6620436
N-(1,3-benzodioxol-5-yl)-3-(4,6,11,13-tetramethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl)propanamide (PubChem CID 6620436) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-(4,6,11,13-tetramethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl)propanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-(4,6,11,13-tetramethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl)propanamide |
|---|---|
| PubChem CID | 6620436 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-(4,6,11,13-tetramethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl)propanamide |
| SMILES | Cc1cc(C)c2c(n1)nn1c(C)c(CCC(=O)Nc3ccc4c(c3)OCO4)c(C)nc21 |
| InChI | InChI=1S/C23H23N5O3/c1-12-9-13(2)24-22-21(12)23-25-14(3)17(15(4)28(23)27-22)6-8-20(29)26-16-5-7-18-19(10-16)31-11-30-18/h5,7,9-10H,6,8,11H2,1-4H3,(H,26,29) |
| InChIKey | HBHLZJPEWUYYED-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |