C24H20N2O3 — CID 6620611
[2-(3-methylphenyl)-4-oxoquinazolin-3-yl] 3,4-dimethylbenzoate (PubChem CID 6620611) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is [2-(3-methylphenyl)-4-oxoquinazolin-3-yl] 3,4-dimethylbenzoate.
| Compound Name | [2-(3-methylphenyl)-4-oxoquinazolin-3-yl] 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 6620611 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | [2-(3-methylphenyl)-4-oxoquinazolin-3-yl] 3,4-dimethylbenzoate |
| SMILES | Cc1cccc(-c2nc3ccccc3c(=O)n2OC(=O)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C24H20N2O3/c1-15-7-6-8-18(13-15)22-25-21-10-5-4-9-20(21)23(27)26(22)29-24(28)19-12-11-16(2)17(3)14-19/h4-14H,1-3H3 |
| InChIKey | VMQDVTVQVQWRIJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |