C27H26N2O3 — CID 23768248
[2-(4-tert-butylphenyl)-4-oxoquinazolin-3-yl] 3,4-dimethylbenzoate (PubChem CID 23768248) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)-4-oxoquinazolin-3-yl] 3,4-dimethylbenzoate.
| Compound Name | [2-(4-tert-butylphenyl)-4-oxoquinazolin-3-yl] 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 23768248 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [2-(4-tert-butylphenyl)-4-oxoquinazolin-3-yl] 3,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)On2c(-c3ccc(C(C)(C)C)cc3)nc3ccccc3c2=O)cc1C |
| InChI | InChI=1S/C27H26N2O3/c1-17-10-11-20(16-18(17)2)26(31)32-29-24(19-12-14-21(15-13-19)27(3,4)5)28-23-9-7-6-8-22(23)25(29)30/h6-16H,1-5H3 |
| InChIKey | BCSJGRUNWYCJBG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |