C27H27N3O4 — CID 23851582
4-tert-butyl-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide (PubChem CID 23851582) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide |
|---|---|
| PubChem CID | 23851582 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 4-tert-butyl-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide |
| SMILES | COc1cc(OC)cc(-c2nc3ccccc3c(=O)n2NC(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C27H27N3O4/c1-27(2,3)19-12-10-17(11-13-19)25(31)29-30-24(18-14-20(33-4)16-21(15-18)34-5)28-23-9-7-6-8-22(23)26(30)32/h6-16H,1-5H3,(H,29,31) |
| InChIKey | BLBPBUQIVJFQKM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |