C27H28N4O4 — CID 6737747
4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide (PubChem CID 6737747) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide.
| Compound Name | 4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide |
|---|---|
| PubChem CID | 6737747 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide |
| SMILES | CCN(CC)c1ccc(C(=O)Nn2c(-c3cc(OC)cc(OC)c3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C27H28N4O4/c1-5-30(6-2)20-13-11-18(12-14-20)26(32)29-31-25(19-15-21(34-3)17-22(16-19)35-4)28-24-10-8-7-9-23(24)27(31)33/h7-17H,5-6H2,1-4H3,(H,29,32) |
| InChIKey | MAYQZMHEOQHILX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |