About 4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide
4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide (PubChem CID 6737747) has the molecular formula C27H28N4O4
and a molecular weight of 472.55 g/mol. Its IUPAC name is 4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide.
Molecular Properties
| Compound Name | 4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide |
| PubChem CID | 6737747 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide |
| SMILES | CCN(CC)c1ccc(C(=O)Nn2c(-c3cc(OC)cc(OC)c3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C27H28N4O4/c1-5-30(6-2)20-13-11-18(12-14-20)26(32)29-31-25(19-15-21(34-3)17-22(16-19)35-4)28-24-10-8-7-9-23(24)27(31)33/h7-17H,5-6H2,1-4H3,(H,29,32) |
| InChIKey | MAYQZMHEOQHILX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide?
The IUPAC name of 4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide (CID 6737747) is 4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide.
What is the SMILES notation for 4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide?
The canonical SMILES for 4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide is CCN(CC)c1ccc(C(=O)Nn2c(-c3cc(OC)cc(OC)c3)nc3ccccc3c2=O)cc1.
What is the InChIKey of 4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide?
The InChIKey is MAYQZMHEOQHILX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28N4O4/c1-5-30(6-2)20-13-11-18(12-14-20)26(32)29-31-25(19-15-21(34-3)17-22(16-19)35-4)28-24-10-8-7-9-23(24)27(31)33/h7-17H,5-6H2,1-4H3,(H,29,32).
What are the key properties of 4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide?
4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide has a molecular weight of 472.55 g/mol, XLogP of 4.31, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethylamino)-N-[2-(3,5-dimethoxyphenyl)-4-oxoquinazolin-3-yl]benzamide is sourced from PubChem (CID 6737747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).