C23H20BrN3O3 — CID 24990560
3-[(4-bromophenyl)methylamino]-2-(3,5-dimethoxyphenyl)quinazolin-4-one (PubChem CID 24990560) has the molecular formula C23H20BrN3O3 and a molecular weight of 466.34 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methylamino]-2-(3,5-dimethoxyphenyl)quinazolin-4-one.
| Compound Name | 3-[(4-bromophenyl)methylamino]-2-(3,5-dimethoxyphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 24990560 |
| Molecular Formula | C23H20BrN3O3 |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 3-[(4-bromophenyl)methylamino]-2-(3,5-dimethoxyphenyl)quinazolin-4-one |
| SMILES | COc1cc(OC)cc(-c2nc3ccccc3c(=O)n2NCc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C23H20BrN3O3/c1-29-18-11-16(12-19(13-18)30-2)22-26-21-6-4-3-5-20(21)23(28)27(22)25-14-15-7-9-17(24)10-8-15/h3-13,25H,14H2,1-2H3 |
| InChIKey | WUDHWQLPPHRIAS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |