C22H17BrFN3O2 — CID 24988336
3-[(4-bromophenyl)methylamino]-2-(2-fluorophenyl)-6-methoxyquinazolin-4-one (PubChem CID 24988336) has the molecular formula C22H17BrFN3O2 and a molecular weight of 454.30 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methylamino]-2-(2-fluorophenyl)-6-methoxyquinazolin-4-one.
| Compound Name | 3-[(4-bromophenyl)methylamino]-2-(2-fluorophenyl)-6-methoxyquinazolin-4-one |
|---|---|
| PubChem CID | 24988336 |
| Molecular Formula | C22H17BrFN3O2 |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 3-[(4-bromophenyl)methylamino]-2-(2-fluorophenyl)-6-methoxyquinazolin-4-one |
| SMILES | COc1ccc2nc(-c3ccccc3F)n(NCc3ccc(Br)cc3)c(=O)c2c1 |
| InChI | InChI=1S/C22H17BrFN3O2/c1-29-16-10-11-20-18(12-16)22(28)27(25-13-14-6-8-15(23)9-7-14)21(26-20)17-4-2-3-5-19(17)24/h2-12,25H,13H2,1H3 |
| InChIKey | FIQRCFPIMUCVMR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |