C24H22BrN3O5 — CID 6615114
3-[(5-bromo-2-hydroxyphenyl)methylamino]-2-(3,4,5-trimethoxyphenyl)quinazolin-4-one (PubChem CID 6615114) has the molecular formula C24H22BrN3O5 and a molecular weight of 512.36 g/mol. Its IUPAC name is 3-[(5-bromo-2-hydroxyphenyl)methylamino]-2-(3,4,5-trimethoxyphenyl)quinazolin-4-one.
| Compound Name | 3-[(5-bromo-2-hydroxyphenyl)methylamino]-2-(3,4,5-trimethoxyphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 6615114 |
| Molecular Formula | C24H22BrN3O5 |
| Molecular Weight | 512.36 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 3-[(5-bromo-2-hydroxyphenyl)methylamino]-2-(3,4,5-trimethoxyphenyl)quinazolin-4-one |
| SMILES | COc1cc(-c2nc3ccccc3c(=O)n2NCc2cc(Br)ccc2O)cc(OC)c1OC |
| InChI | InChI=1S/C24H22BrN3O5/c1-31-20-11-14(12-21(32-2)22(20)33-3)23-27-18-7-5-4-6-17(18)24(30)28(23)26-13-15-10-16(25)8-9-19(15)29/h4-12,26,29H,13H2,1-3H3 |
| InChIKey | SUKUKVSJHMQRQM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|